C28H50O6Si — CID 68752509
2-[2-[(5aR,6S,7R,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-5,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid (PubChem CID 68752509) has the molecular formula C28H50O6Si and a molecular weight of 510.79 g/mol. Its IUPAC name is 2-[2-[(5aR,6S,7R,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-5,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid.
| Compound Name | 2-[2-[(5aR,6S,7R,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-5,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid |
|---|---|
| PubChem CID | 68752509 |
| Molecular Formula | C28H50O6Si |
| Molecular Weight | 510.79 g/mol |
| Exact Mass | 510.34 |
| IUPAC Name | 2-[2-[(5aR,6S,7R,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-5,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-3-yl]ethyl]pentanoic acid |
| SMILES | CCCC(CCC1=CC[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](OC3CCCCO3)C[C@@H]2OC1)C(=O)O |
| InChI | InChI=1S/C28H50O6Si/c1-7-10-21(27(29)30)14-12-20-13-15-22-23(19-33-35(5,6)28(2,3)4)25(17-24(22)32-18-20)34-26-11-8-9-16-31-26/h13,21-26H,7-12,14-19H2,1-6H3,(H,29,30)/t21?,22-,23-,24+,25-,26?/m1/s1 |
| InChIKey | VXFLDGPQWAMYBO-CWVZZBLFSA-N |
| XLogP | 6.55 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.79 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|