C27H50O6Si — CID 68750857
2-[[(2R,5aR,6S,7R,8aS)-6-[[dimethyl(2-methylpropyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-2-yl]methyl]pentanoic acid (PubChem CID 68750857) has the molecular formula C27H50O6Si and a molecular weight of 498.78 g/mol. Its IUPAC name is 2-[[(2R,5aR,6S,7R,8aS)-6-[[dimethyl(2-methylpropyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-2-yl]methyl]pentanoic acid.
| Compound Name | 2-[[(2R,5aR,6S,7R,8aS)-6-[[dimethyl(2-methylpropyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-2-yl]methyl]pentanoic acid |
|---|---|
| PubChem CID | 68750857 |
| Molecular Formula | C27H50O6Si |
| Molecular Weight | 498.78 g/mol |
| Exact Mass | 498.34 |
| IUPAC Name | 2-[[(2R,5aR,6S,7R,8aS)-6-[[dimethyl(2-methylpropyl)silyl]oxymethyl]-7-(oxan-2-yloxy)-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-2-yl]methyl]pentanoic acid |
| SMILES | CCCC(C[C@H]1CCC[C@@H]2[C@@H](CO[Si](C)(C)CC(C)C)[C@H](OC3CCCCO3)C[C@@H]2O1)C(=O)O |
| InChI | InChI=1S/C27H50O6Si/c1-6-10-20(27(28)29)15-21-11-9-12-22-23(17-31-34(4,5)18-19(2)3)25(16-24(22)32-21)33-26-13-7-8-14-30-26/h19-26H,6-18H2,1-5H3,(H,28,29)/t20?,21-,22-,23-,24+,25-,26?/m1/s1 |
| InChIKey | SXTNVNLHZINWFR-PFJSYOSPSA-N |
| XLogP | 6.24 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.78 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|