C23H40O6Si — CID 90000742
(2R,5aR,6S,7R,8aS)-6-[[dimethyl(2-methylpropyl)silyl]oxymethyl]-2-methyl-7-(oxan-2-yloxy)-3,5a,6,7,8,8a-hexahydrocyclopenta[b]oxepine-2-carboxylic acid (PubChem CID 90000742) has the molecular formula C23H40O6Si and a molecular weight of 440.65 g/mol. Its IUPAC name is (2R,5aR,6S,7R,8aS)-6-[[dimethyl(2-methylpropyl)silyl]oxymethyl]-2-methyl-7-(oxan-2-yloxy)-3,5a,6,7,8,8a-hexahydrocyclopenta[b]oxepine-2-carboxylic acid.
| Compound Name | (2R,5aR,6S,7R,8aS)-6-[[dimethyl(2-methylpropyl)silyl]oxymethyl]-2-methyl-7-(oxan-2-yloxy)-3,5a,6,7,8,8a-hexahydrocyclopenta[b]oxepine-2-carboxylic acid |
|---|---|
| PubChem CID | 90000742 |
| Molecular Formula | C23H40O6Si |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | (2R,5aR,6S,7R,8aS)-6-[[dimethyl(2-methylpropyl)silyl]oxymethyl]-2-methyl-7-(oxan-2-yloxy)-3,5a,6,7,8,8a-hexahydrocyclopenta[b]oxepine-2-carboxylic acid |
| SMILES | CC(C)C[Si](C)(C)OC[C@@H]1[C@H]2C=CC[C@](C)(C(=O)O)O[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C23H40O6Si/c1-16(2)15-30(4,5)27-14-18-17-9-8-11-23(3,22(24)25)29-20(17)13-19(18)28-21-10-6-7-12-26-21/h8-9,16-21H,6-7,10-15H2,1-5H3,(H,24,25)/t17-,18-,19-,20+,21?,23-/m1/s1 |
| InChIKey | MBCMVNJQDUEGDJ-FCQSYMBXSA-N |
| XLogP | 4.60 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|