C25H40O8 — CID 22840112
methyl 2-[3-hydroxy-2-[(4S,5R)-5-(oxan-2-yloxy)-4-(oxan-2-yloxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propoxy]acetate (PubChem CID 22840112) has the molecular formula C25H40O8 and a molecular weight of 468.59 g/mol. Its IUPAC name is methyl 2-[3-hydroxy-2-[(4S,5R)-5-(oxan-2-yloxy)-4-(oxan-2-yloxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propoxy]acetate.
| Compound Name | methyl 2-[3-hydroxy-2-[(4S,5R)-5-(oxan-2-yloxy)-4-(oxan-2-yloxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propoxy]acetate |
|---|---|
| PubChem CID | 22840112 |
| Molecular Formula | C25H40O8 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | methyl 2-[3-hydroxy-2-[(4S,5R)-5-(oxan-2-yloxy)-4-(oxan-2-yloxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propoxy]acetate |
| SMILES | COC(=O)COCC(CO)C1=CC2C(C1)C[C@@H](OC1CCCCO1)[C@@H]2COC1CCCCO1 |
| InChI | InChI=1S/C25H40O8/c1-28-23(27)16-29-14-19(13-26)17-10-18-12-22(33-25-7-3-5-9-31-25)21(20(18)11-17)15-32-24-6-2-4-8-30-24/h11,18-22,24-26H,2-10,12-16H2,1H3/t18?,19?,20?,21-,22-,24?,25?/m1/s1 |
| InChIKey | FFORFAXGFRPGPK-QESJASEPSA-N |
| XLogP | 2.82 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|