C35H58O9S — CID 88602398
[6-methylsulfonyloxy-5-[(4R,5R)-5-(oxan-2-yloxy)-4-[8-(oxan-2-yloxy)oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]hexyl] acetate (PubChem CID 88602398) has the molecular formula C35H58O9S and a molecular weight of 654.91 g/mol. Its IUPAC name is [6-methylsulfonyloxy-5-[(4R,5R)-5-(oxan-2-yloxy)-4-[8-(oxan-2-yloxy)oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]hexyl] acetate.
| Compound Name | [6-methylsulfonyloxy-5-[(4R,5R)-5-(oxan-2-yloxy)-4-[8-(oxan-2-yloxy)oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]hexyl] acetate |
|---|---|
| PubChem CID | 88602398 |
| Molecular Formula | C35H58O9S |
| Molecular Weight | 654.91 g/mol |
| Exact Mass | 654.38 |
| IUPAC Name | [6-methylsulfonyloxy-5-[(4R,5R)-5-(oxan-2-yloxy)-4-[8-(oxan-2-yloxy)oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]hexyl] acetate |
| SMILES | CC(=O)OCCCCC(COS(C)(=O)=O)C1=CC2C(C1)C[C@@H](OC1CCCCO1)[C@@H]2C=CCCCCCCOC1CCCCO1 |
| InChI | InChI=1S/C35H58O9S/c1-27(36)39-19-12-8-15-28(26-43-45(2,37)38)29-23-30-25-33(44-35-18-10-14-22-42-35)31(32(30)24-29)16-7-5-3-4-6-11-20-40-34-17-9-13-21-41-34/h7,16,24,28,30-35H,3-6,8-15,17-23,25-26H2,1-2H3/t28?,30?,31-,32?,33-,34?,35?/m1/s1 |
| InChIKey | LVFLJRPJHJLNOL-ARYMIWJDSA-N |
| XLogP | 6.86 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.91 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|