C44H76O7Si — CID 70410567
[6-[tert-butyl(dimethyl)silyl]oxy-5-[6-[2-methyl-8-(oxan-2-yloxy)undeca-2,9-dien-6-yl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]hexyl] acetate (PubChem CID 70410567) has the molecular formula C44H76O7Si and a molecular weight of 745.17 g/mol. Its IUPAC name is [6-[tert-butyl(dimethyl)silyl]oxy-5-[6-[2-methyl-8-(oxan-2-yloxy)undeca-2,9-dien-6-yl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]hexyl] acetate.
| Compound Name | [6-[tert-butyl(dimethyl)silyl]oxy-5-[6-[2-methyl-8-(oxan-2-yloxy)undeca-2,9-dien-6-yl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]hexyl] acetate |
|---|---|
| PubChem CID | 70410567 |
| Molecular Formula | C44H76O7Si |
| Molecular Weight | 745.17 g/mol |
| Exact Mass | 744.54 |
| IUPAC Name | [6-[tert-butyl(dimethyl)silyl]oxy-5-[6-[2-methyl-8-(oxan-2-yloxy)undeca-2,9-dien-6-yl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]hexyl] acetate |
| SMILES | CC=CC(CC(CCC=C(C)C)C1C(OC2CCCCO2)CC2C=C(C(CCCCOC(C)=O)CO[Si](C)(C)C(C)(C)C)CC21)OC1CCCCO1 |
| InChI | InChI=1S/C44H76O7Si/c1-10-18-38(50-41-22-12-15-25-47-41)28-34(21-17-19-32(2)3)43-39-29-36(27-37(39)30-40(43)51-42-23-13-16-26-48-42)35(20-11-14-24-46-33(4)45)31-49-52(8,9)44(5,6)7/h10,18-19,27,34-35,37-43H,11-17,20-26,28-31H2,1-9H3 |
| InChIKey | IFILEBGRVBKULP-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.17 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|