C37H60O10S — CID 173407741
methyl 2-[1-[4-[2-methyl-8-(oxan-2-yloxy)undeca-2,9-dien-6-yl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-methylsulfonyloxypropan-2-yl]oxyacetate (PubChem CID 173407741) has the molecular formula C37H60O10S and a molecular weight of 696.94 g/mol. Its IUPAC name is methyl 2-[1-[4-[2-methyl-8-(oxan-2-yloxy)undeca-2,9-dien-6-yl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-methylsulfonyloxypropan-2-yl]oxyacetate.
| Compound Name | methyl 2-[1-[4-[2-methyl-8-(oxan-2-yloxy)undeca-2,9-dien-6-yl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-methylsulfonyloxypropan-2-yl]oxyacetate |
|---|---|
| PubChem CID | 173407741 |
| Molecular Formula | C37H60O10S |
| Molecular Weight | 696.94 g/mol |
| Exact Mass | 696.39 |
| IUPAC Name | methyl 2-[1-[4-[2-methyl-8-(oxan-2-yloxy)undeca-2,9-dien-6-yl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-methylsulfonyloxypropan-2-yl]oxyacetate |
| SMILES | CC=CC(CC(CCC=C(C)C)C1C(OC2CCCCO2)CC2CC(C(OS(C)(=O)=O)C(C)OCC(=O)OC)=CC21)OC1CCCCO1 |
| InChI | InChI=1S/C37H60O10S/c1-7-13-30(45-34-16-8-10-18-42-34)21-27(15-12-14-25(2)3)36-31-22-29(20-28(31)23-32(36)46-35-17-9-11-19-43-35)37(47-48(6,39)40)26(4)44-24-33(38)41-5/h7,13-14,22,26-28,30-32,34-37H,8-12,15-21,23-24H2,1-6H3 |
| InChIKey | QUTGBIUPTQTPIH-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.94 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|