C26H42O10S — CID 22840128
methyl 2-[3-methylsulfonyloxy-2-[(4S,5R)-5-(oxan-2-yloxy)-4-(oxan-2-yloxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propoxy]acetate (PubChem CID 22840128) has the molecular formula C26H42O10S and a molecular weight of 546.68 g/mol. Its IUPAC name is methyl 2-[3-methylsulfonyloxy-2-[(4S,5R)-5-(oxan-2-yloxy)-4-(oxan-2-yloxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propoxy]acetate.
| Compound Name | methyl 2-[3-methylsulfonyloxy-2-[(4S,5R)-5-(oxan-2-yloxy)-4-(oxan-2-yloxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propoxy]acetate |
|---|---|
| PubChem CID | 22840128 |
| Molecular Formula | C26H42O10S |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | methyl 2-[3-methylsulfonyloxy-2-[(4S,5R)-5-(oxan-2-yloxy)-4-(oxan-2-yloxymethyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]propoxy]acetate |
| SMILES | COC(=O)COCC(COS(C)(=O)=O)C1=CC2C(C1)C[C@@H](OC1CCCCO1)[C@@H]2COC1CCCCO1 |
| InChI | InChI=1S/C26H42O10S/c1-30-24(27)17-31-14-20(15-35-37(2,28)29)18-11-19-13-23(36-26-8-4-6-10-33-26)22(21(19)12-18)16-34-25-7-3-5-9-32-25/h12,19-23,25-26H,3-11,13-17H2,1-2H3/t19?,20?,21?,22-,23-,25?,26?/m1/s1 |
| InChIKey | YGYSERJBGBCAKC-ZBTZWDAMSA-N |
| XLogP | 2.81 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|