C42H74O6Si — CID 70410664
6-[tert-butyl(dimethyl)silyl]oxy-5-[6-[2-methyl-8-(oxan-2-yloxy)undeca-2,9-dien-6-yl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]hexan-1-ol (PubChem CID 70410664) has the molecular formula C42H74O6Si and a molecular weight of 703.13 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-5-[6-[2-methyl-8-(oxan-2-yloxy)undeca-2,9-dien-6-yl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]hexan-1-ol.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-5-[6-[2-methyl-8-(oxan-2-yloxy)undeca-2,9-dien-6-yl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 70410664 |
| Molecular Formula | C42H74O6Si |
| Molecular Weight | 703.13 g/mol |
| Exact Mass | 702.53 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-5-[6-[2-methyl-8-(oxan-2-yloxy)undeca-2,9-dien-6-yl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]hexan-1-ol |
| SMILES | CC=CC(CC(CCC=C(C)C)C1C(OC2CCCCO2)CC2C=C(C(CCCCO)CO[Si](C)(C)C(C)(C)C)CC21)OC1CCCCO1 |
| InChI | InChI=1S/C42H74O6Si/c1-9-17-36(47-39-21-11-14-24-44-39)27-32(20-16-18-31(2)3)41-37-28-34(26-35(37)29-38(41)48-40-22-12-15-25-45-40)33(19-10-13-23-43)30-46-49(7,8)42(4,5)6/h9,17-18,26,32-33,35-41,43H,10-16,19-25,27-30H2,1-8H3 |
| InChIKey | UTFVQAGLJOVMPX-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.13 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|