C36H60O7 — CID 57065071
7-[(1R,2R,3R,5S)-2-[(3S)-7-methyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-en-1-ol (PubChem CID 57065071) has the molecular formula C36H60O7 and a molecular weight of 604.87 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[(3S)-7-methyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-en-1-ol.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[(3S)-7-methyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-en-1-ol |
|---|---|
| PubChem CID | 57065071 |
| Molecular Formula | C36H60O7 |
| Molecular Weight | 604.87 g/mol |
| Exact Mass | 604.43 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[(3S)-7-methyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-en-1-ol |
| SMILES | CC(C)=CCC[C@@H](C=C[C@@H]1[C@@H](CC=CCCCCO)[C@@H](OC2CCCCO2)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C36H60O7/c1-28(2)15-14-16-29(41-34-18-7-11-24-38-34)21-22-31-30(17-6-4-3-5-10-23-37)32(42-35-19-8-12-25-39-35)27-33(31)43-36-20-9-13-26-40-36/h4,6,15,21-22,29-37H,3,5,7-14,16-20,23-27H2,1-2H3/t29-,30+,31+,32-,33+,34?,35?,36?/m0/s1 |
| InChIKey | WVABJISSADGNCM-ZYTVMIJXSA-N |
| XLogP | 7.77 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.87 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|