C42H65BrO9S — CID 70158766
(Z)-8-[(1R,2R,3R,5S)-2-[(E)-5-(5-bromothiophen-2-yl)-3-[(2R)-oxan-2-yl]oxypent-1-enyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-1-(oxan-2-yloxy)oct-6-en-2-ol (PubChem CID 70158766) has the molecular formula C42H65BrO9S and a molecular weight of 825.94 g/mol. Its IUPAC name is (Z)-8-[(1R,2R,3R,5S)-2-[(E)-5-(5-bromothiophen-2-yl)-3-[(2R)-oxan-2-yl]oxypent-1-enyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-1-(oxan-2-yloxy)oct-6-en-2-ol.
| Compound Name | (Z)-8-[(1R,2R,3R,5S)-2-[(E)-5-(5-bromothiophen-2-yl)-3-[(2R)-oxan-2-yl]oxypent-1-enyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-1-(oxan-2-yloxy)oct-6-en-2-ol |
|---|---|
| PubChem CID | 70158766 |
| Molecular Formula | C42H65BrO9S |
| Molecular Weight | 825.94 g/mol |
| Exact Mass | 824.35 |
| IUPAC Name | (Z)-8-[(1R,2R,3R,5S)-2-[(E)-5-(5-bromothiophen-2-yl)-3-[(2R)-oxan-2-yl]oxypent-1-enyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]-1-(oxan-2-yloxy)oct-6-en-2-ol |
| SMILES | OC(CCC/C=C\C[C@@H]1[C@@H](/C=C/C(CCc2ccc(Br)s2)O[C@@H]2CCCCO2)[C@H](OC2CCCCO2)C[C@@H]1OC1CCCCO1)COC1CCCCO1 |
| InChI | InChI=1S/C42H65BrO9S/c43-38-24-22-33(53-38)21-19-32(50-40-16-6-10-26-46-40)20-23-35-34(14-4-2-1-3-13-31(44)30-49-39-15-5-9-25-45-39)36(51-41-17-7-11-27-47-41)29-37(35)52-42-18-8-12-28-48-42/h2,4,20,22-24,31-32,34-37,39-42,44H,1,3,5-19,21,25-30H2/b4-2-,23-20+/t31?,32?,34-,35-,36+,37-,39?,40-,41?,42?/m1/s1 |
| InChIKey | QNTAESAPCSULGL-OLANRRKESA-N |
| XLogP | 9.39 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.94 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|