C22H44O5Si — CID 14410088
4-[(1R,2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(hydroxymethyl)-3-(oxan-2-yloxy)cyclopentyl]butan-1-ol (PubChem CID 14410088) has the molecular formula C22H44O5Si and a molecular weight of 416.68 g/mol. Its IUPAC name is 4-[(1R,2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(hydroxymethyl)-3-(oxan-2-yloxy)cyclopentyl]butan-1-ol.
| Compound Name | 4-[(1R,2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(hydroxymethyl)-3-(oxan-2-yloxy)cyclopentyl]butan-1-ol |
|---|---|
| PubChem CID | 14410088 |
| Molecular Formula | C22H44O5Si |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | 4-[(1R,2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(hydroxymethyl)-3-(oxan-2-yloxy)cyclopentyl]butan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1[C@H](CCCCO)[C@H](CO)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C22H44O5Si/c1-22(2,3)28(4,5)26-16-19-18(10-6-8-12-23)17(15-24)14-20(19)27-21-11-7-9-13-25-21/h17-21,23-24H,6-16H2,1-5H3/t17-,18+,19-,20-,21?/m0/s1 |
| InChIKey | VWWZIVHLLBITOQ-MLVLIFOTSA-N |
| XLogP | 4.33 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|