C25H38O10 — CID 88838745
2-[(1R,2R,3S,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[8-[(3,4,5,6-tetrahydroxy-2H-pyran-2-yl)oxy]oct-1-enyl]cyclopentyl]acetaldehyde (PubChem CID 88838745) has the molecular formula C25H38O10 and a molecular weight of 498.57 g/mol. Its IUPAC name is 2-[(1R,2R,3S,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[8-[(3,4,5,6-tetrahydroxy-2H-pyran-2-yl)oxy]oct-1-enyl]cyclopentyl]acetaldehyde.
| Compound Name | 2-[(1R,2R,3S,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[8-[(3,4,5,6-tetrahydroxy-2H-pyran-2-yl)oxy]oct-1-enyl]cyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 88838745 |
| Molecular Formula | C25H38O10 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 2-[(1R,2R,3S,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[8-[(3,4,5,6-tetrahydroxy-2H-pyran-2-yl)oxy]oct-1-enyl]cyclopentyl]acetaldehyde |
| SMILES | O=CC[C@@H]1[C@@H](C=CCCCCCCOC2OC(O)=C(O)C(O)=C2O)[C@@H](OC2CCCCO2)C[C@@H]1O |
| InChI | InChI=1S/C25H38O10/c26-12-11-16-17(19(15-18(16)27)34-20-10-6-8-13-32-20)9-5-3-1-2-4-7-14-33-25-23(30)21(28)22(29)24(31)35-25/h5,9,12,16-20,25,27-31H,1-4,6-8,10-11,13-15H2/t16-,17-,18+,19+,20?,25?/m1/s1 |
| InChIKey | IUAPTWPNOFULDA-CVZUOMPVSA-N |
| XLogP | 3.98 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|