C28H50F2O5Si — CID 59958164
(4R)-4-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorodecyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 59958164) has the molecular formula C28H50F2O5Si and a molecular weight of 532.79 g/mol. Its IUPAC name is (4R)-4-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorodecyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (4R)-4-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorodecyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 59958164 |
| Molecular Formula | C28H50F2O5Si |
| Molecular Weight | 532.79 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | (4R)-4-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorodecyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCCCC(F)(F)C(CC[C@H]1C(OC2CCCCO2)CC2OC(=O)CC21)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H50F2O5Si/c1-7-8-9-11-16-28(29,30)24(35-36(5,6)27(2,3)4)15-14-20-21-18-25(31)33-23(21)19-22(20)34-26-13-10-12-17-32-26/h20-24,26H,7-19H2,1-6H3/t20-,21?,22?,23?,24?,26?/m1/s1 |
| InChIKey | ZLHUFBFBGMWBBC-MSDIFSAJSA-N |
| XLogP | 7.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.79 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|