C23H35NO3Si — CID 10621100
ethyl (1S,3aR,4R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-phenyl-3a,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-1-carboxylate (PubChem CID 10621100) has the molecular formula C23H35NO3Si and a molecular weight of 401.62 g/mol. Its IUPAC name is ethyl (1S,3aR,4R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-phenyl-3a,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-1-carboxylate.
| Compound Name | ethyl (1S,3aR,4R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-phenyl-3a,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 10621100 |
| Molecular Formula | C23H35NO3Si |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | ethyl (1S,3aR,4R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-phenyl-3a,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1N=C(c2ccccc2)[C@H]2[C@@H]1CC[C@@]2(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H35NO3Si/c1-8-26-21(25)20-17-14-15-23(5,27-28(6,7)22(2,3)4)18(17)19(24-20)16-12-10-9-11-13-16/h9-13,17-18,20H,8,14-15H2,1-7H3/t17-,18+,20-,23+/m0/s1 |
| InChIKey | BUMFSXCUXVDENX-JGQIHZOTSA-N |
| XLogP | 5.23 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|