C29H36O3Si — CID 11590724
ethyl (1aR,6aS)-4-[tert-butyl(diphenyl)silyl]oxy-1,1a,2,3,4,5,6,6a-octahydrocyclopropa[f]indene-1-carboxylate (PubChem CID 11590724) has the molecular formula C29H36O3Si and a molecular weight of 460.69 g/mol. Its IUPAC name is ethyl (1aR,6aS)-4-[tert-butyl(diphenyl)silyl]oxy-1,1a,2,3,4,5,6,6a-octahydrocyclopropa[f]indene-1-carboxylate.
| Compound Name | ethyl (1aR,6aS)-4-[tert-butyl(diphenyl)silyl]oxy-1,1a,2,3,4,5,6,6a-octahydrocyclopropa[f]indene-1-carboxylate |
|---|---|
| PubChem CID | 11590724 |
| Molecular Formula | C29H36O3Si |
| Molecular Weight | 460.69 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | ethyl (1aR,6aS)-4-[tert-butyl(diphenyl)silyl]oxy-1,1a,2,3,4,5,6,6a-octahydrocyclopropa[f]indene-1-carboxylate |
| SMILES | CCOC(=O)C1[C@H]2CC3=C(CC(O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)C3)C[C@@H]12 |
| InChI | InChI=1S/C29H36O3Si/c1-5-31-28(30)27-25-18-20-16-22(17-21(20)19-26(25)27)32-33(29(2,3)4,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-15,22,25-27H,5,16-19H2,1-4H3/t22?,25-,26+,27? |
| InChIKey | JWCXGMCRTJVUQW-NORFSPMMSA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.69 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|