C21H41NO5Si — CID 69438814
1-O-tert-butyl 3-O-ethyl 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperidine-1,3-dicarboxylate (PubChem CID 69438814) has the molecular formula C21H41NO5Si and a molecular weight of 415.65 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 69438814 |
| Molecular Formula | C21H41NO5Si |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperidine-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1(CCO[Si](C)(C)C(C)(C)C)CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H41NO5Si/c1-10-25-17(23)21(13-15-26-28(8,9)20(5,6)7)12-11-14-22(16-21)18(24)27-19(2,3)4/h10-16H2,1-9H3 |
| InChIKey | ZFJVZYZKJLRLIA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|