C22H41NO6Si — CID 175692291
tert-butyl 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-methoxy-3-oxopropanoyl)piperidine-1-carboxylate (PubChem CID 175692291) has the molecular formula C22H41NO6Si and a molecular weight of 443.66 g/mol. Its IUPAC name is tert-butyl 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-methoxy-3-oxopropanoyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-methoxy-3-oxopropanoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175692291 |
| Molecular Formula | C22H41NO6Si |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | tert-butyl 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-methoxy-3-oxopropanoyl)piperidine-1-carboxylate |
| SMILES | COC(=O)CC(=O)C1(CCO[Si](C)(C)C(C)(C)C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H41NO6Si/c1-20(2,3)29-19(26)23-13-10-22(11-14-23,17(24)16-18(25)27-7)12-15-28-30(8,9)21(4,5)6/h10-16H2,1-9H3 |
| InChIKey | YTJPFXCNIVIJOY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|