C27H46N2O3Si — CID 67500751
tert-butyl 2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]phenyl]-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 67500751) has the molecular formula C27H46N2O3Si and a molecular weight of 474.76 g/mol. Its IUPAC name is tert-butyl 2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]phenyl]-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]phenyl]-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 67500751 |
| Molecular Formula | C27H46N2O3Si |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | tert-butyl 2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]phenyl]-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CCN(c1ccc(CCO[Si](C)(C)C(C)(C)C)cc1)C2 |
| InChI | InChI=1S/C27H46N2O3Si/c1-25(2,3)32-24(30)28-17-14-27(15-18-28)16-19-29(21-27)23-11-9-22(10-12-23)13-20-31-33(7,8)26(4,5)6/h9-12H,13-21H2,1-8H3 |
| InChIKey | ITQCOIZGDKEKOM-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|