C19H29N3O3 — CID 164518063
tert-butyl (1R,5S)-7-[4-(2-aminoethyl)phenyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 164518063) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl (1R,5S)-7-[4-(2-aminoethyl)phenyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate.
| Compound Name | tert-butyl (1R,5S)-7-[4-(2-aminoethyl)phenyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| PubChem CID | 164518063 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | tert-butyl (1R,5S)-7-[4-(2-aminoethyl)phenyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CN(c3ccc(CCN)cc3)C[C@H](C1)O2 |
| InChI | InChI=1S/C19H29N3O3/c1-19(2,3)25-18(23)22-12-16-10-21(11-17(13-22)24-16)15-6-4-14(5-7-15)8-9-20/h4-7,16-17H,8-13,20H2,1-3H3/t16-,17+ |
| InChIKey | AONDVRCWRDGLRK-CALCHBBNSA-N |
| XLogP | 2.01 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|