C21H42N2O3Si — CID 166071441
tert-butyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 166071441) has the molecular formula C21H42N2O3Si and a molecular weight of 398.66 g/mol. Its IUPAC name is tert-butyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 166071441 |
| Molecular Formula | C21H42N2O3Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | tert-butyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCN2CCO[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H42N2O3Si/c1-19(2,3)26-18(24)22-14-11-21(12-15-22)10-9-13-23(21)16-17-25-27(7,8)20(4,5)6/h9-17H2,1-8H3 |
| InChIKey | PVPVZNPXVZXWJJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|