C18H38N2O3Si — CID 58007307
tert-butyl (3R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylpiperazine-1-carboxylate (PubChem CID 58007307) has the molecular formula C18H38N2O3Si and a molecular weight of 358.60 g/mol. Its IUPAC name is tert-butyl (3R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 58007307 |
| Molecular Formula | C18H38N2O3Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | tert-butyl (3R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)CCN1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38N2O3Si/c1-15-14-20(16(21)23-17(2,3)4)11-10-19(15)12-13-22-24(8,9)18(5,6)7/h15H,10-14H2,1-9H3/t15-/m1/s1 |
| InChIKey | FTCQSPROSYOEFS-OAHLLOKOSA-N |
| XLogP | 3.95 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|