C16H29N3O4 — CID 58735548
tert-butyl 3-methyl-4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carboxylate (PubChem CID 58735548) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is tert-butyl 3-methyl-4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58735548 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | tert-butyl 3-methyl-4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN1CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H29N3O4/c1-13-11-19(15(21)23-16(2,3)4)6-5-18(13)12-14(20)17-7-9-22-10-8-17/h13H,5-12H2,1-4H3 |
| InChIKey | HREHFSBYBMJKNC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |