C13H24N2O3 — CID 138550018
tert-butyl (3R)-3-methyl-4-(oxetan-3-yl)piperazine-1-carboxylate (PubChem CID 138550018) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is tert-butyl (3R)-3-methyl-4-(oxetan-3-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-methyl-4-(oxetan-3-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 138550018 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | tert-butyl (3R)-3-methyl-4-(oxetan-3-yl)piperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)CCN1C1COC1 |
| InChI | InChI=1S/C13H24N2O3/c1-10-7-14(12(16)18-13(2,3)4)5-6-15(10)11-8-17-9-11/h10-11H,5-9H2,1-4H3/t10-/m1/s1 |
| InChIKey | PPDLLKMZZCKJQZ-SNVBAGLBSA-N |
| XLogP | 1.33 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |