C10H19N2O4S- — CID 143536848
2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-1-sulfinate (PubChem CID 143536848) has the molecular formula C10H19N2O4S- and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-1-sulfinate.
| Compound Name | 2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-1-sulfinate |
|---|---|
| PubChem CID | 143536848 |
| Molecular Formula | C10H19N2O4S- |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-1-sulfinate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN1S(=O)[O-] |
| InChI | InChI=1S/C10H20N2O4S/c1-8-7-11(5-6-12(8)17(14)15)9(13)16-10(2,3)4/h8H,5-7H2,1-4H3,(H,14,15)/p-1 |
| InChIKey | RDFPRFZGBRGWTK-UHFFFAOYSA-M |
| XLogP | 0.72 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|