C9H16NO4S- — CID 58348222
[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]methanesulfinate (PubChem CID 58348222) has the molecular formula C9H16NO4S- and a molecular weight of 234.30 g/mol. Its IUPAC name is [1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]methanesulfinate.
| Compound Name | [1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]methanesulfinate |
|---|---|
| PubChem CID | 58348222 |
| Molecular Formula | C9H16NO4S- |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | [1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]methanesulfinate |
| SMILES | CC(C)(C)OC(=O)N1CC(CS(=O)[O-])C1 |
| InChI | InChI=1S/C9H17NO4S/c1-9(2,3)14-8(11)10-4-7(5-10)6-15(12)13/h7H,4-6H2,1-3H3,(H,12,13)/p-1 |
| InChIKey | DGZNFXCFUCEEAS-UHFFFAOYSA-M |
| XLogP | 0.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|