C10H18NO4S- — CID 58348292
1-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]ethanesulfinate (PubChem CID 58348292) has the molecular formula C10H18NO4S- and a molecular weight of 248.32 g/mol. Its IUPAC name is 1-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]ethanesulfinate.
| Compound Name | 1-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]ethanesulfinate |
|---|---|
| PubChem CID | 58348292 |
| Molecular Formula | C10H18NO4S- |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]ethanesulfinate |
| SMILES | CC(C1CN(C(=O)OC(C)(C)C)C1)S(=O)[O-] |
| InChI | InChI=1S/C10H19NO4S/c1-7(16(13)14)8-5-11(6-8)9(12)15-10(2,3)4/h7-8H,5-6H2,1-4H3,(H,13,14)/p-1 |
| InChIKey | CQPJSQJZANNYFO-UHFFFAOYSA-M |
| XLogP | 1.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|