C15H29N3O2 — CID 86700515
tert-butyl (3S)-3-methyl-4-piperidin-4-ylpiperazine-1-carboxylate (PubChem CID 86700515) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is tert-butyl (3S)-3-methyl-4-piperidin-4-ylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-methyl-4-piperidin-4-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 86700515 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | tert-butyl (3S)-3-methyl-4-piperidin-4-ylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)CCN1C1CCNCC1 |
| InChI | InChI=1S/C15H29N3O2/c1-12-11-17(14(19)20-15(2,3)4)9-10-18(12)13-5-7-16-8-6-13/h12-13,16H,5-11H2,1-4H3/t12-/m0/s1 |
| InChIKey | HFQRBLYMOWCSQM-LBPRGKRZSA-N |
| XLogP | 1.68 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |