C17H30ClN3O4 — CID 165454299
tert-butyl 4-[5-(chloromethoxycarbonyl)piperidin-3-yl]-3-methylpiperazine-1-carboxylate (PubChem CID 165454299) has the molecular formula C17H30ClN3O4 and a molecular weight of 375.90 g/mol. Its IUPAC name is tert-butyl 4-[5-(chloromethoxycarbonyl)piperidin-3-yl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(chloromethoxycarbonyl)piperidin-3-yl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 165454299 |
| Molecular Formula | C17H30ClN3O4 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | tert-butyl 4-[5-(chloromethoxycarbonyl)piperidin-3-yl]-3-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN1C1CNCC(C(=O)OCCl)C1 |
| InChI | InChI=1S/C17H30ClN3O4/c1-12-10-20(16(23)25-17(2,3)4)5-6-21(12)14-7-13(8-19-9-14)15(22)24-11-18/h12-14,19H,5-11H2,1-4H3 |
| InChIKey | JCBHZZYEOSFHRT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|