C13H22ClNO4 — CID 165438815
1-O-tert-butyl 4-O-(chloromethyl) (2R,4S)-2-methylpiperidine-1,4-dicarboxylate (PubChem CID 165438815) has the molecular formula C13H22ClNO4 and a molecular weight of 291.78 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-(chloromethyl) (2R,4S)-2-methylpiperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-(chloromethyl) (2R,4S)-2-methylpiperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 165438815 |
| Molecular Formula | C13H22ClNO4 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 1-O-tert-butyl 4-O-(chloromethyl) (2R,4S)-2-methylpiperidine-1,4-dicarboxylate |
| SMILES | C[C@@H]1C[C@@H](C(=O)OCCl)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22ClNO4/c1-9-7-10(11(16)18-8-14)5-6-15(9)12(17)19-13(2,3)4/h9-10H,5-8H2,1-4H3/t9-,10+/m1/s1 |
| InChIKey | OUZANLOUVQMOMY-ZJUUUORDSA-N |
| XLogP | 2.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|