C22H40I2N2O4 — CID 175815373
tert-butyl (2S)-4-iodo-2-methylpiperidine-1-carboxylate (PubChem CID 175815373) has the molecular formula C22H40I2N2O4 and a molecular weight of 650.38 g/mol. Its IUPAC name is tert-butyl (2S)-4-iodo-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-iodo-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 175815373 |
| Molecular Formula | C22H40I2N2O4 |
| Molecular Weight | 650.38 g/mol |
| Exact Mass | 650.11 |
| IUPAC Name | tert-butyl (2S)-4-iodo-2-methylpiperidine-1-carboxylate |
| SMILES | C[C@H]1CC(I)CCN1C(=O)OC(C)(C)C.C[C@H]1CC(I)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/2C11H20INO2/c2*1-8-7-9(12)5-6-13(8)10(14)15-11(2,3)4/h2*8-9H,5-7H2,1-4H3/t2*8-,9?/m00/s1 |
| InChIKey | RADKYEBPFIAMDY-DCVCIBJTSA-N |
| XLogP | 6.42 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.38 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|