C15H29NO2 — CID 102268017
tert-butyl (2S)-4-tert-butyl-2-methylpiperidine-1-carboxylate (PubChem CID 102268017) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is tert-butyl (2S)-4-tert-butyl-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-tert-butyl-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 102268017 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | tert-butyl (2S)-4-tert-butyl-2-methylpiperidine-1-carboxylate |
| SMILES | C[C@H]1CC(C(C)(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO2/c1-11-10-12(14(2,3)4)8-9-16(11)13(17)18-15(5,6)7/h11-12H,8-10H2,1-7H3/t11-,12?/m0/s1 |
| InChIKey | LABFHTAJVLWYLX-PXYINDEMSA-N |
| XLogP | 4.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |