C17H26N2O2 — CID 97305072
tert-butyl (2R,4R)-4-(4-aminophenyl)-2-methylpiperidine-1-carboxylate (PubChem CID 97305072) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is tert-butyl (2R,4R)-4-(4-aminophenyl)-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-4-(4-aminophenyl)-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 97305072 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | tert-butyl (2R,4R)-4-(4-aminophenyl)-2-methylpiperidine-1-carboxylate |
| SMILES | C[C@@H]1C[C@H](c2ccc(N)cc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26N2O2/c1-12-11-14(13-5-7-15(18)8-6-13)9-10-19(12)16(20)21-17(2,3)4/h5-8,12,14H,9-11,18H2,1-4H3/t12-,14-/m1/s1 |
| InChIKey | LSCFWKDIVOBNKW-TZMCWYRMSA-N |
| XLogP | 3.77 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|