C19H27NO4 — CID 177300820
tert-butyl 4-(4-methoxycarbonylphenyl)-2-methylpiperidine-1-carboxylate (PubChem CID 177300820) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is tert-butyl 4-(4-methoxycarbonylphenyl)-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-methoxycarbonylphenyl)-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 177300820 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | tert-butyl 4-(4-methoxycarbonylphenyl)-2-methylpiperidine-1-carboxylate |
| SMILES | COC(=O)c1ccc(C2CCN(C(=O)OC(C)(C)C)C(C)C2)cc1 |
| InChI | InChI=1S/C19H27NO4/c1-13-12-16(10-11-20(13)18(22)24-19(2,3)4)14-6-8-15(9-7-14)17(21)23-5/h6-9,13,16H,10-12H2,1-5H3 |
| InChIKey | RDHPNGIVXTWOKO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |