C19H25NO6 — CID 138971510
1-O-tert-butyl 2-O-methyl (2S,4S)-4-(4-methoxycarbonylphenyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 138971510) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4S)-4-(4-methoxycarbonylphenyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-(4-methoxycarbonylphenyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 138971510 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-(4-methoxycarbonylphenyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc([C@@H]2C[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C19H25NO6/c1-19(2,3)26-18(23)20-11-14(10-15(20)17(22)25-5)12-6-8-13(9-7-12)16(21)24-4/h6-9,14-15H,10-11H2,1-5H3/t14-,15+/m1/s1 |
| InChIKey | OTNHKQWUUMCIFW-CABCVRRESA-N |
| XLogP | 2.74 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|