C12H17ClF3NO4 — CID 165438949
1-O-tert-butyl 2-O-(chloromethyl) (2S,3R)-3-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 165438949) has the molecular formula C12H17ClF3NO4 and a molecular weight of 331.72 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-(chloromethyl) (2S,3R)-3-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-(chloromethyl) (2S,3R)-3-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 165438949 |
| Molecular Formula | C12H17ClF3NO4 |
| Molecular Weight | 331.72 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 1-O-tert-butyl 2-O-(chloromethyl) (2S,3R)-3-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C(F)(F)F)[C@H]1C(=O)OCCl |
| InChI | InChI=1S/C12H17ClF3NO4/c1-11(2,3)21-10(19)17-5-4-7(12(14,15)16)8(17)9(18)20-6-13/h7-8H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | XBZLIVZBALXZIS-SFYZADRCSA-N |
| XLogP | 2.91 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.72 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|