C10H16ClNO4S — CID 85120063
3-O-tert-butyl 4-O-(chloromethyl) 1,3-thiazolidine-3,4-dicarboxylate (PubChem CID 85120063) has the molecular formula C10H16ClNO4S and a molecular weight of 281.76 g/mol. Its IUPAC name is 3-O-tert-butyl 4-O-(chloromethyl) 1,3-thiazolidine-3,4-dicarboxylate.
| Compound Name | 3-O-tert-butyl 4-O-(chloromethyl) 1,3-thiazolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 85120063 |
| Molecular Formula | C10H16ClNO4S |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3-O-tert-butyl 4-O-(chloromethyl) 1,3-thiazolidine-3,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CSCC1C(=O)OCCl |
| InChI | InChI=1S/C10H16ClNO4S/c1-10(2,3)16-9(14)12-6-17-4-7(12)8(13)15-5-11/h7H,4-6H2,1-3H3 |
| InChIKey | QXPHXDKAFODANP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|