C14H25NO6S — CID 95631649
3-O-tert-butyl 4-O-[2-(2-methoxyethoxy)ethyl] (4R)-1,3-thiazolidine-3,4-dicarboxylate (PubChem CID 95631649) has the molecular formula C14H25NO6S and a molecular weight of 335.42 g/mol. Its IUPAC name is 3-O-tert-butyl 4-O-[2-(2-methoxyethoxy)ethyl] (4R)-1,3-thiazolidine-3,4-dicarboxylate.
| Compound Name | 3-O-tert-butyl 4-O-[2-(2-methoxyethoxy)ethyl] (4R)-1,3-thiazolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 95631649 |
| Molecular Formula | C14H25NO6S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-O-tert-butyl 4-O-[2-(2-methoxyethoxy)ethyl] (4R)-1,3-thiazolidine-3,4-dicarboxylate |
| SMILES | COCCOCCOC(=O)[C@@H]1CSCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO6S/c1-14(2,3)21-13(17)15-10-22-9-11(15)12(16)20-8-7-19-6-5-18-4/h11H,5-10H2,1-4H3/t11-/m0/s1 |
| InChIKey | FDMVJXFDHDTHRG-NSHDSACASA-N |
| XLogP | 1.50 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|