About tert-butyl (4S)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate
tert-butyl (4S)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate (PubChem CID 7145120) has the molecular formula C9H18N2O2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is tert-butyl (4S)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate.
Analyze tert-butyl (4S)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4S)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate?
The IUPAC name of tert-butyl (4S)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate (CID 7145120) is tert-butyl (4S)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate.
What is the SMILES notation for tert-butyl (4S)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate?
The canonical SMILES for tert-butyl (4S)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate is CC(C)(C)OC(=O)N1CSC[C@@H]1CN.
What is the InChIKey of tert-butyl (4S)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate?
The InChIKey is XRUIGLRQDKZXKJ-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H18N2O2S/c1-9(2,3)13-8(12)11-6-14-5-7(11)4-10/h7H,4-6,10H2,1-3H3/t7-/m0/s1.
What are the key properties of tert-butyl (4S)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate?
tert-butyl (4S)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate has a molecular weight of 218.32 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4S)-4-(aminomethyl)-1,3-thiazolidine-3-carboxylate is sourced from PubChem (CID 7145120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).