C12H18F3NO4 — CID 165458872
2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(trifluoromethyl)pyrrolidin-2-yl]acetic acid (PubChem CID 165458872) has the molecular formula C12H18F3NO4 and a molecular weight of 297.27 g/mol. Its IUPAC name is 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(trifluoromethyl)pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(trifluoromethyl)pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 165458872 |
| Molecular Formula | C12H18F3NO4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(trifluoromethyl)pyrrolidin-2-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(F)(F)F)C1CC(=O)O |
| InChI | InChI=1S/C12H18F3NO4/c1-11(2,3)20-10(19)16-5-4-7(12(13,14)15)8(16)6-9(17)18/h7-8H,4-6H2,1-3H3,(H,17,18) |
| InChIKey | NYTMTQJFTSQUCV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |