C11H22N4O3 — CID 174991389
tert-butyl 4-(N'-hydroxycarbamimidoyl)-3-methylpiperazine-1-carboxylate (PubChem CID 174991389) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is tert-butyl 4-(N'-hydroxycarbamimidoyl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(N'-hydroxycarbamimidoyl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 174991389 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | tert-butyl 4-(N'-hydroxycarbamimidoyl)-3-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN1C(N)=NO |
| InChI | InChI=1S/C11H22N4O3/c1-8-7-14(10(16)18-11(2,3)4)5-6-15(8)9(12)13-17/h8,17H,5-7H2,1-4H3,(H2,12,13) |
| InChIKey | BTSAPILTDPVSGW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|