C15H29NO5 — CID 101053581
ethyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,3-dimethylbutanoate (PubChem CID 101053581) has the molecular formula C15H29NO5 and a molecular weight of 303.40 g/mol. Its IUPAC name is ethyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,3-dimethylbutanoate.
| Compound Name | ethyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 101053581 |
| Molecular Formula | C15H29NO5 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | ethyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,3-dimethylbutanoate |
| SMILES | CCOC(=O)[C@](C)(C(C)C)N(COC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO5/c1-9-20-12(17)15(7,11(2)3)16(10-19-8)13(18)21-14(4,5)6/h11H,9-10H2,1-8H3/t15-/m0/s1 |
| InChIKey | RBLDXVXJOMMLHY-HNNXBMFYSA-N |
| XLogP | 2.81 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|