C19H30N2O5 — CID 154810075
tert-butyl N-(1-aminocyclohexyl)carbamate;(2R)-2-hydroxy-2-phenylacetic acid (PubChem CID 154810075) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is tert-butyl N-(1-aminocyclohexyl)carbamate;(2R)-2-hydroxy-2-phenylacetic acid.
| Compound Name | tert-butyl N-(1-aminocyclohexyl)carbamate;(2R)-2-hydroxy-2-phenylacetic acid |
|---|---|
| PubChem CID | 154810075 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | tert-butyl N-(1-aminocyclohexyl)carbamate;(2R)-2-hydroxy-2-phenylacetic acid |
| SMILES | CC(C)(C)OC(=O)NC1(N)CCCCC1.O=C(O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C11H22N2O2.C8H8O3/c1-10(2,3)15-9(14)13-11(12)7-5-4-6-8-11;9-7(8(10)11)6-4-2-1-3-5-6/h4-8,12H2,1-3H3,(H,13,14);1-5,7,9H,(H,10,11)/t;7-/m.1/s1 |
| InChIKey | AVKMBBIWRCIVIC-HMZWWLAASA-N |
| XLogP | 2.93 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|