C18H26N2O2 — CID 174406182
tert-butyl 2-(4,4-diaminocyclohexa-1,5-dien-1-yl)benzoate;methane (PubChem CID 174406182) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is tert-butyl 2-(4,4-diaminocyclohexa-1,5-dien-1-yl)benzoate;methane.
| Compound Name | tert-butyl 2-(4,4-diaminocyclohexa-1,5-dien-1-yl)benzoate;methane |
|---|---|
| PubChem CID | 174406182 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | tert-butyl 2-(4,4-diaminocyclohexa-1,5-dien-1-yl)benzoate;methane |
| SMILES | C.CC(C)(C)OC(=O)c1ccccc1C1=CCC(N)(N)C=C1 |
| InChI | InChI=1S/C17H22N2O2.CH4/c1-16(2,3)21-15(20)14-7-5-4-6-13(14)12-8-10-17(18,19)11-9-12;/h4-10H,11,18-19H2,1-3H3;1H4 |
| InChIKey | XGWUNLIXTBANDH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|