tert-butyl 2-(4-pentan-3-ylphenyl)benzoate

C22H28O2 — CID 57014037

IUPACtert-butyl 2-(4-pentan-3-ylphenyl)benzoate
SMILESCCC(CC)c1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1
InChIInChI=1S/C22H28O2/c1-6-16(7-2)17-12-14-18(15-13-17)19-10-8-9-11-20(19)21(23)24-22(3,4)5/h8-16H,6-7H2,1-5H3
InChIKeyFJHUZFKBMMERTH-UHFFFAOYSA-N
MW324.46 g/mol
LogP6.21
Rot. Bonds5

About tert-butyl 2-(4-pentan-3-ylphenyl)benzoate

tert-butyl 2-(4-pentan-3-ylphenyl)benzoate (PubChem CID 57014037) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is tert-butyl 2-(4-pentan-3-ylphenyl)benzoate.

Molecular Properties

Compound Nametert-butyl 2-(4-pentan-3-ylphenyl)benzoate
PubChem CID57014037
Molecular FormulaC22H28O2
Molecular Weight324.46 g/mol
Exact Mass324.21
IUPAC Nametert-butyl 2-(4-pentan-3-ylphenyl)benzoate
SMILESCCC(CC)c1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1
InChIInChI=1S/C22H28O2/c1-6-16(7-2)17-12-14-18(15-13-17)19-10-8-9-11-20(19)21(23)24-22(3,4)5/h8-16H,6-7H2,1-5H3
InChIKeyFJHUZFKBMMERTH-UHFFFAOYSA-N
XLogP6.21
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500324.46
LogP ≤ 56.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze tert-butyl 2-(4-pentan-3-ylphenyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2-(4-pentan-3-ylphenyl)benzoate?
The IUPAC name of tert-butyl 2-(4-pentan-3-ylphenyl)benzoate (CID 57014037) is tert-butyl 2-(4-pentan-3-ylphenyl)benzoate.
What is the SMILES notation for tert-butyl 2-(4-pentan-3-ylphenyl)benzoate?
The canonical SMILES for tert-butyl 2-(4-pentan-3-ylphenyl)benzoate is CCC(CC)c1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1.
What is the InChIKey of tert-butyl 2-(4-pentan-3-ylphenyl)benzoate?
The InChIKey is FJHUZFKBMMERTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O2/c1-6-16(7-2)17-12-14-18(15-13-17)19-10-8-9-11-20(19)21(23)24-22(3,4)5/h8-16H,6-7H2,1-5H3.
What are the key properties of tert-butyl 2-(4-pentan-3-ylphenyl)benzoate?
tert-butyl 2-(4-pentan-3-ylphenyl)benzoate has a molecular weight of 324.46 g/mol, XLogP of 6.21, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(4-pentan-3-ylphenyl)benzoate is sourced from PubChem (CID 57014037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).