C25H30N2O2 — CID 10023303
tert-butyl 2-[4-[(5-butylimidazol-1-yl)methyl]phenyl]benzoate (PubChem CID 10023303) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is tert-butyl 2-[4-[(5-butylimidazol-1-yl)methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[(5-butylimidazol-1-yl)methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 10023303 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | tert-butyl 2-[4-[(5-butylimidazol-1-yl)methyl]phenyl]benzoate |
| SMILES | CCCCc1cncn1Cc1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H30N2O2/c1-5-6-9-21-16-26-18-27(21)17-19-12-14-20(15-13-19)22-10-7-8-11-23(22)24(28)29-25(2,3)4/h7-8,10-16,18H,5-6,9,17H2,1-4H3 |
| InChIKey | NAFGHQZRHWFXIB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |