C23H20O4 — CID 11152606
17-methoxycarbonylhexacyclo[14.2.1.114,17.01,14.02,7.08,13]icosa-2,4,6,8,10,12-hexaene-16-carboxylic acid (PubChem CID 11152606) has the molecular formula C23H20O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 17-methoxycarbonylhexacyclo[14.2.1.114,17.01,14.02,7.08,13]icosa-2,4,6,8,10,12-hexaene-16-carboxylic acid.
| Compound Name | 17-methoxycarbonylhexacyclo[14.2.1.114,17.01,14.02,7.08,13]icosa-2,4,6,8,10,12-hexaene-16-carboxylic acid |
|---|---|
| PubChem CID | 11152606 |
| Molecular Formula | C23H20O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 17-methoxycarbonylhexacyclo[14.2.1.114,17.01,14.02,7.08,13]icosa-2,4,6,8,10,12-hexaene-16-carboxylic acid |
| SMILES | COC(=O)C12CC34CC1(C(=O)O)CC3(C2)c1ccccc1-c1ccccc14 |
| InChI | InChI=1S/C23H20O4/c1-27-19(26)23-12-20-10-22(23,18(24)25)11-21(20,13-23)17-9-5-3-7-15(17)14-6-2-4-8-16(14)20/h2-9H,10-13H2,1H3,(H,24,25) |
| InChIKey | SGJOTLNWZVCSON-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |