C24H22O4 — CID 174872515
cyclopenta-1,3-diene;dimethyl 3-phenylindene-1,1-dicarboxylate (PubChem CID 174872515) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dimethyl 3-phenylindene-1,1-dicarboxylate.
| Compound Name | cyclopenta-1,3-diene;dimethyl 3-phenylindene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 174872515 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | cyclopenta-1,3-diene;dimethyl 3-phenylindene-1,1-dicarboxylate |
| SMILES | C1=CCC=C1.COC(=O)C1(C(=O)OC)C=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H16O4.C5H6/c1-22-17(20)19(18(21)23-2)12-15(13-8-4-3-5-9-13)14-10-6-7-11-16(14)19;1-2-4-5-3-1/h3-12H,1-2H3;1-4H,5H2 |
| InChIKey | MMKIIYIKPBLTPP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|