C22H28O2 — CID 67951263
1-[4-(2,5-dibutyl-3-hydroxyphenyl)phenyl]ethanone (PubChem CID 67951263) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is 1-[4-(2,5-dibutyl-3-hydroxyphenyl)phenyl]ethanone.
| Compound Name | 1-[4-(2,5-dibutyl-3-hydroxyphenyl)phenyl]ethanone |
|---|---|
| PubChem CID | 67951263 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 1-[4-(2,5-dibutyl-3-hydroxyphenyl)phenyl]ethanone |
| SMILES | CCCCc1cc(O)c(CCCC)c(-c2ccc(C(C)=O)cc2)c1 |
| InChI | InChI=1S/C22H28O2/c1-4-6-8-17-14-21(20(9-7-5-2)22(24)15-17)19-12-10-18(11-13-19)16(3)23/h10-15,24H,4-9H2,1-3H3 |
| InChIKey | ZBDZLCKXGDMYGU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |