C29H44O2 — CID 86052181
3,5-dibutyl-2-[(2,4-dibutyl-6-hydroxyphenyl)methyl]phenol (PubChem CID 86052181) has the molecular formula C29H44O2 and a molecular weight of 424.67 g/mol. Its IUPAC name is 3,5-dibutyl-2-[(2,4-dibutyl-6-hydroxyphenyl)methyl]phenol.
| Compound Name | 3,5-dibutyl-2-[(2,4-dibutyl-6-hydroxyphenyl)methyl]phenol |
|---|---|
| PubChem CID | 86052181 |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | 3,5-dibutyl-2-[(2,4-dibutyl-6-hydroxyphenyl)methyl]phenol |
| SMILES | CCCCc1cc(O)c(Cc2c(O)cc(CCCC)cc2CCCC)c(CCCC)c1 |
| InChI | InChI=1S/C29H44O2/c1-5-9-13-22-17-24(15-11-7-3)26(28(30)19-22)21-27-25(16-12-8-4)18-23(14-10-6-2)20-29(27)31/h17-20,30-31H,5-16,21H2,1-4H3 |
| InChIKey | YTLNPNPWGZAEER-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |